2-Methylsuccinic acid: Difference between revisions
Content deleted Content added
raney Ni |
more ids and hazards |
||
Line 4: | Line 4: | ||
| ImageAlt = |
| ImageAlt = |
||
| IUPACName = |
| IUPACName = |
||
| OtherNames = Pyrotartaric acid |
| OtherNames = Pyrotartaric acid; 2-methylbutanedioic acid; propane-1,2-dicarboxylic acid |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
| CASNo = 498-21-5 |
| CASNo = 498-21-5 |
||
| PubChem = |
| PubChem = 10349 |
||
| |
| EC_number = 207-857-1 |
||
| ChEBI = 91315 |
|||
| UNII = H1547KG7UZ |
|||
| ChemSpiderID = 9922 |
|||
| StdInChI=1S/C5H8O4/c1-3(5(8)9)2-4(6)7/h3H,2H2,1H3,(H,6,7)(H,8,9) |
|||
| StdInChIKey = WXUAQHNMJWJLTG-UHFFFAOYSA-N |
|||
| SMILES = CC(CC(=O)O)C(=O)O |
|||
}} |
|||
|Section2={{Chembox Properties |
|Section2={{Chembox Properties |
||
| C=5|H=8|O=4 |
| C=5|H=8|O=4 |
||
Line 18: | Line 25: | ||
| Solubility = }} |
| Solubility = }} |
||
|Section3={{Chembox Hazards |
|Section3={{Chembox Hazards |
||
| GHSPictograms = {{GHS07}} |
|||
| GHSSignalWord = Warning |
|||
| HPhrases = {{H-phrases|315|319|335}} |
|||
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|||
| MainHazards = |
| MainHazards = |
||
| FlashPt = |
| FlashPt = |
Revision as of 21:51, 20 February 2019
Names | |
---|---|
Other names
Pyrotartaric acid; 2-methylbutanedioic acid; propane-1,2-dicarboxylic acid
| |
Identifiers | |
3D model (JSmol)
|
|
ChEBI | |
ChemSpider | |
ECHA InfoCard | 100.007.144 |
EC Number |
|
PubChem CID
|
|
UNII | |
CompTox Dashboard (EPA)
|
|
| |
| |
Properties | |
C5H8O4 | |
Molar mass | 132.115 g·mol−1 |
Appearance | white solid |
Melting point | 117.5 °C (243.5 °F; 390.6 K) |
Hazards | |
GHS labelling: | |
Warning | |
H315, H319, H335 | |
P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, P501 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
2-Methylsuccinic acid is an organic compound with the formula HO2CCH(CH3)CH2CO2H. A white solid, it is the simplest chiral dicarboxylic acid. It is prepared by partial hydrogenation of itaconic acid over Raney nickel.[1] It is a recurring component of urban aerosols.[2] Salts of 2-methylsuccinic acid are called 2-methylsuccinates.
References
- ^ "3-Methylthiophene". Org.Synth. 34: 73. 1954. doi:10.15227/orgsyn.034.0073.
{{cite journal}}
: Cite uses deprecated parameter|authors=
(help) - ^ "Seasonal Changes in the Distribution of Dicarboxylic Acids in the Urban Atmosphere". Environmental Science and Technology. 27: 2227–35. 1993. doi:10.1021/es00047a033.
{{cite journal}}
: Cite uses deprecated parameter|authors=
(help)